CAS 762272-51-5

4-(Difluoromethoxy)benzenethiol

Description:

4-(Difluoromethoxy)benzenethiol, with the CAS number 762272-51-5, is an organic compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that also features a difluoromethoxy (-O-CHF2) substituent at the para position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits properties common to thiols, such as a strong, often unpleasant odor, and is known for its reactivity due to the sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions and oxidation. The difluoromethoxy group enhances the compound's polarity and can influence its solubility in organic solvents. Additionally, the presence of fluorine atoms may impart unique electronic properties, potentially affecting its reactivity and interactions with other chemical species. Overall, 4-(Difluoromethoxy)benzenethiol is of interest in various fields, including pharmaceuticals and materials science, due to its functional groups and potential applications.

Formula: C₇H₆F₂OS

InChI: InChI=1S/C7H6F2OS/c8-7(9)10-5-1-3-6(11)4-2-5/h1-4,7,11H

InChI key: InChIKey=UBIFQDYCLKNERP-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC=C(S)C=C1

Synonyms:

• 4-(Difluoromethoxy)benzenethiol
• 4-Difluoromethoxybenzenethiol
• Benzenethiol, 4-(difluoromethoxy)-