
CAS 76233-81-3
:4-[2-[4-(Benzoylamino)-2-methoxy-5-methylphenyl]diazenyl]-3-hydroxy-N-phenyl-2-naphthalenecarboxamide
Description:
The chemical substance known as 4-[2-[4-(Benzoylamino)-2-methoxy-5-methylphenyl]diazenyl]-3-hydroxy-N-phenyl-2-naphthalenecarboxamide, with the CAS number 76233-81-3, is a complex organic compound characterized by its azo dye structure. This compound features a diazo group (-N=N-) which is commonly associated with vibrant colors, making it useful in dye applications. The presence of multiple aromatic rings, including naphthalene and phenyl groups, contributes to its stability and potential for pi-pi stacking interactions. The functional groups, such as the hydroxyl (-OH) and amide (-CONH-) groups, suggest that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. Additionally, the methoxy (-OCH3) and benzoyl (-C(O)Ph) substituents can affect its electronic properties and steric hindrance. Overall, this compound may have applications in fields such as dye chemistry, materials science, and potentially in biological systems, depending on its specific interactions and properties.
Formula:C32H26N4O4
InChI:InChI=1S/C32H26N4O4/c1-20-17-27(28(40-2)19-26(20)34-31(38)21-11-5-3-6-12-21)35-36-29-24-16-10-9-13-22(24)18-25(30(29)37)32(39)33-23-14-7-4-8-15-23/h3-19,37H,1-2H3,(H,33,39)(H,34,38)
InChI key:InChIKey=ZHCVURIUBDGMAR-UHFFFAOYSA-N
SMILES:N(=NC1=C(OC)C=C(NC(=O)C2=CC=CC=C2)C(C)=C1)C=3C4=C(C=C(C(NC5=CC=CC=C5)=O)C3O)C=CC=C4
Synonyms:- 2-Naphthalenecarboxamide, 4-[2-[4-(benzoylamino)-2-methoxy-5-methylphenyl]diazenyl]-3-hydroxy-N-phenyl-
- 2-Naphthanilide, 4-(4-benzamido-6-methoxy-m-tolylazo)-3-hydroxy-
- C.I. Pigment Violet 50
- 2-Naphthalenecarboxamide, 4-[[4-(benzoylamino)-2-methoxy-5-methylphenyl]azo]-3-hydroxy-N-phenyl-
- 4-[2-[4-(Benzoylamino)-2-methoxy-5-methylphenyl]diazenyl]-3-hydroxy-N-phenyl-2-naphthalenecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.