CAS 76234-38-3

3-(pyrrolidin-1-yl)propanoic acid

Description:

3-(Pyrrolidin-1-yl)propanoic acid, with the CAS number 76234-38-3, is an organic compound characterized by its structure, which includes a propanoic acid moiety attached to a pyrrolidine ring. This compound features a five-membered nitrogen-containing heterocycle, which contributes to its potential biological activity. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The pyrrolidine ring can influence the compound's solubility, stability, and interaction with biological systems, making it of interest in medicinal chemistry and drug design. Additionally, the compound may exhibit properties such as being a potential neurotransmitter or modulator, given the role of similar structures in biological processes. Its synthesis typically involves straightforward organic reactions, and it can be characterized using techniques like NMR spectroscopy and mass spectrometry. Overall, 3-(pyrrolidin-1-yl)propanoic acid is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₁₃NO₂

InChI: InChI=1/C7H13NO2/c9-7(10)3-6-8-4-1-2-5-8/h1-6H2,(H,9,10)

SMILES: C1CCN(C1)CCC(=O)O

Synonyms:

• 1-Pyrrolidinepropanoic acid
• 3-(Pyrrolidin-1-Yl)Propionic Acid

3-pyrrolidin-1-ylpropionic acid

CAS: 76234-38-3

Formula: C₇H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 143.1836

Ref: IN-DA0035YV

3-(Pyrrolidin-1-yl)propanoic acid

CAS: 76234-38-3

3-(Pyrrolidin-1-yl)propanoic acid

Purity: 95%

Molecular weight: 143.18g/mol

Ref: 54-OR1010716

3-Pyrrolidin-1-yl-propionic acid

CAS: 76234-38-3

Formula: C₇H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 143.186

Ref: 10-F028340