CAS 7624-35-3
:1-tert-butyl-1,2-dihydro-5H-tetrazole-5-thione
Description:
1-tert-butyl-1,2-dihydro-5H-tetrazole-5-thione, with the CAS number 7624-35-3, is a heterocyclic compound characterized by its tetrazole ring structure, which contains four nitrogen atoms and one carbon atom. This compound features a tert-butyl group, contributing to its hydrophobic characteristics and influencing its solubility in organic solvents. The presence of a thione functional group (R-SH) indicates that it has sulfur in its structure, which can impart unique reactivity and stability properties. Typically, compounds like this exhibit moderate to low toxicity and can be used in various applications, including as intermediates in organic synthesis or in the development of pharmaceuticals. The compound's stability is often influenced by the presence of the thione group, which can participate in various chemical reactions, including nucleophilic attacks. Overall, 1-tert-butyl-1,2-dihydro-5H-tetrazole-5-thione is notable for its unique structural features and potential utility in chemical synthesis and research.
Formula:C5H10N4S
InChI:InChI=1/C5H10N4S/c1-5(2,3)9-4(10)6-7-8-9/h1-3H3,(H,6,8,10)
SMILES:CC(C)(C)n1c(nnn1)S
Synonyms:- 1-tert-Butyl-1,4-dihydro-5H-tetrazole-5-thione
- 1-tert-butyl-1H-tetrazole-5-thiol
- 1-Tert-Butyl-2,5-Dihydro-1,2,3,4-Tetrazole-5-Thione
- 1-tert-Butyl-5-mercapto-1H-tetrazole
- 5H-tetrazole-5-thione, 1-(1,1-dimethylethyl)-1,4-dihydro-
- 7624-35-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.