CAS 76240-14-7
:ethyl 2-methylpyrimidine-4-carboxylate
Description:
Ethyl 2-methylpyrimidine-4-carboxylate, with the CAS number 76240-14-7, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the specific conditions. Ethyl 2-methylpyrimidine-4-carboxylate is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a building block in various chemical reactions. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, it may exhibit moderate polarity, influencing its solubility in organic solvents and water. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c1-3-12-8(11)7-4-5-9-6(2)10-7/h4-5H,3H2,1-2H3
SMILES:CCOC(=O)c1ccnc(C)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
ethyl 2-methylpyrimidine-4-carboxylate
CAS:Formula:C8H10N2O2Purity:95%Color and Shape:LiquidMolecular weight:166.1772Ethyl 2-methylpyrimidine-4-carboxylate
CAS:Ethyl 2-methylpyrimidine-4-carboxylate is a quaternary ammonium salt that is used in the synthesis of other compounds. It has been shown to have an annulation reaction with pyridine and pyrimidine derivatives. The ring structure of this compound consists of a pyridine ring with two methyl groups on the nitrogen atoms.Formula:C8H10N2O2Purity:Min. 95%Molecular weight:166.18 g/mol


