CAS 76240-34-1

[2-(3-methylbut-3-enyl)phenyl] acetate

Description:

[2-(3-methylbut-3-enyl)phenyl] acetate, with the CAS number 76240-34-1, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and a phenolic compound. This substance features a phenyl ring substituted with a 3-methylbut-3-enyl group, contributing to its unique structural properties. The presence of the alkene in the side chain can impart reactivity, particularly in addition reactions. Typically, compounds like this may exhibit moderate volatility and can be soluble in organic solvents, while being less soluble in water due to their hydrophobic nature. The compound may also possess aromatic characteristics, which can influence its odor and potential applications in flavoring or fragrance industries. Additionally, the specific arrangement of substituents can affect its physical properties, such as boiling point and melting point, as well as its reactivity in various chemical reactions. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₃H₁₆O₂

InChI: InChI=1/C13H16O2/c1-10(2)8-9-12-6-4-5-7-13(12)15-11(3)14/h4-7H,1,8-9H2,2-3H3

SMILES: C=C(C)CCc1ccccc1OC(=O)C