CAS 76243-25-9
:Benzenamine, 3-fluoro-4-(phenylmethoxy)-, hydrochloride (1:1)
Description:
Benzenamine, 3-fluoro-4-(phenylmethoxy)-, hydrochloride (1:1), with the CAS number 76243-25-9, is a chemical compound characterized by its amine functional group and the presence of a fluorine atom on the benzene ring. This compound features a phenylmethoxy group, which contributes to its overall structure and properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the fluorine atom can influence the compound's reactivity, stability, and biological activity, making it of interest in medicinal chemistry. The compound may exhibit specific pharmacological properties, potentially acting as a building block for drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C13H12FNO·ClH
InChI:InChI=1S/C13H12FNO.ClH/c14-12-8-11(15)6-7-13(12)16-9-10-4-2-1-3-5-10;/h1-8H,9,15H2;1H
InChI key:InChIKey=GWWCZRDLDLFAIR-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(F)C=C(N)C=C2.Cl
Synonyms:- Benzenamine, 3-fluoro-4-(phenylmethoxy)-, hydrochloride
- 4-(Benzyloxy)-3-fluoroaniline hydrochloride
- Benzenamine, 3-fluoro-4-(phenylmethoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
