CAS 76254-70-1

2-(4-nitrophenyl)ethanethioamide

Description:

2-(4-Nitrophenyl)ethanethioamide, with the CAS number 76254-70-1, is an organic compound characterized by the presence of a thioamide functional group and a nitrophenyl moiety. This compound typically exhibits a yellow crystalline appearance due to the nitro group, which can influence its electronic properties and reactivity. The thioamide group (-C(S)NH2) is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The presence of the nitro group (-NO2) on the phenyl ring enhances the compound's electrophilicity, making it a potential candidate for further chemical transformations. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Overall, 2-(4-nitrophenyl)ethanethioamide is a versatile compound with potential uses in organic synthesis and pharmaceuticals.

Formula: C₈H₈N₂O₂S

InChI: InChI=1/C8H8N2O2S/c9-8(13)5-6-1-3-7(4-2-6)10(11)12/h1-4H,5H2,(H2,9,13)

SMILES: c1cc(ccc1CC(=N)S)N(=O)=O

2-(4-Nitrophenyl)thioacetamide

CAS: 76254-70-1

2-(4-Nitrophenyl)thioacetamide

Formula: C₈H₈N₂O₂S

Purity: ≥95%

Color and Shape: brown crystalline solid

Molecular weight: 196.22632g/mol

Ref: 54-OR24109

2-(4-Nitrophenyl)ethanethioamide

CAS: 76254-70-1

Purity: 97%

Molecular weight: 196.2200012

Ref: 10-F749064