CAS 76263-13-3
:Fluzinamide
Description:
Fluzinamide is a chemical compound classified as a pyridine derivative, primarily known for its application in agricultural practices, particularly as a fungicide. It exhibits a broad spectrum of activity against various fungal pathogens, making it valuable in crop protection. The molecular structure of fluzinamide includes functional groups that contribute to its efficacy and stability. It is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which influences its application methods and environmental behavior. Fluzinamide acts by inhibiting specific biochemical pathways in fungi, disrupting their growth and reproduction. Safety assessments indicate that, while effective, it should be handled with care due to potential toxicity to non-target organisms. Regulatory agencies evaluate its use to ensure environmental safety and human health protection. Overall, fluzinamide represents a significant tool in integrated pest management strategies, contributing to sustainable agricultural practices.
Formula:C12H13F3N2O2
InChI:InChI=1/C12H13F3N2O2/c1-16-11(18)17-6-10(7-17)19-9-4-2-3-8(5-9)12(13,14)15/h2-5,10H,6-7H2,1H3,(H,16,18)
SMILES:CN=C(N1CC(C1)Oc1cccc(c1)C(F)(F)F)O
Synonyms:- Fluzinamide [USAN:INN]
- 1-Azetidinecarboxamide, N-methyl-3-(3-(trifluoromethyl)phenoxy)-
- Ahr 8559
- Fluzinamida
- Fluzinamida [Spanish]
- Fluzinamidum
- Fluzinamidum [Latin]
- N-Methyl-3-((alpha,alpha,alpha-trifluoro-m-tolyl)oxy)-1-azetidinecarboxamide
- Unii-Iaf7F741Sx
- N-methyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fluzinamide
CAS:<p>Fluzinamide is a growth regulator that is typically used to treat epilepsy and other neurological disorders. It has been shown to be effective in the treatment of certain types of epilepsy, such as partial seizures, generalized tonic-clonic seizures, and mixed seizure patterns. Fluzinamide is administered orally or by injection and can be reconstituted with sterile water for intravenous administration. The plasma concentration of fluzinamide is higher than its serum concentration because it is highly protein bound. Fluzinamide is metabolized by conjugation with fatty acids and fatty acid metabolites. These metabolites are excreted through the urine and bile after conjugation with glucuronic acid. Fluzinamide also binds to diagnostic agents such as radioactive iodine or technetium-99m, allowing them to bind to thyroid tissue in order to image the gland for treatment purposes. The terminal half-life of fluzinamide ranges from 18 hours (4 hours when given intravenously</p>Formula:C12H13F3N2O2Purity:Min. 95%Molecular weight:274.24 g/molFluzinamide
CAS:<p>Fluzinamide (AHR-8559) has anticonvulsant effects on ignited amygdala seizures.</p>Formula:C12H13F3N2O2Purity:99.38% - >99.99%Color and Shape:SolidMolecular weight:274.24


