CymitQuimica logo

CAS 76263-25-7

:

3-(3-Azetidinyloxy)benzamide

Description:
3-(3-Azetidinyloxy)benzamide, identified by its CAS number 76263-25-7, is a chemical compound characterized by the presence of an azetidine ring and a benzamide functional group. The azetidine moiety contributes to its potential as a building block in medicinal chemistry, often influencing the compound's biological activity and pharmacological properties. The benzamide structure typically enhances solubility and stability, making it suitable for various applications in drug development. This compound may exhibit specific interactions with biological targets, which can be explored for therapeutic purposes. Its synthesis involves standard organic reactions, and its properties can be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. As with many compounds containing nitrogen and oxygen heteroatoms, 3-(3-Azetidinyloxy)benzamide may display interesting reactivity and can participate in further chemical transformations. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c11-10(13)7-2-1-3-8(4-7)14-9-5-12-6-9/h1-4,9,12H,5-6H2,(H2,11,13)
InChI key:InChIKey=CCXGQYXFUVSJEW-UHFFFAOYSA-N
SMILES:O(C1=CC(C(N)=O)=CC=C1)C2CNC2
Synonyms:
  • Benzamide, 3-(3-azetidinyloxy)-
  • 3-(3-Azetidinyloxy)benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.