CAS 76264-07-8

L-Lysine, N-[(phenylmethoxy)carbonyl]-L-alanyl-

Description:

L-Lysine, N-[(phenylmethoxy)carbonyl]-L-alanyl- is a synthetic compound that belongs to the class of amino acid derivatives. It features a lysine backbone, which is an essential amino acid known for its role in protein synthesis and various metabolic processes. The presence of the phenylmethoxycarbonyl group indicates that this compound is likely a protected form of the amino acid, which is commonly used in peptide synthesis to prevent unwanted reactions during chemical transformations. The structure suggests that it may exhibit properties typical of amino acids, such as solubility in polar solvents and the ability to form hydrogen bonds. Additionally, the compound may have applications in pharmaceuticals or biochemistry, particularly in the development of peptide-based drugs or as a building block in the synthesis of more complex molecules. As with many amino acid derivatives, it may also exhibit specific biological activities, although detailed studies would be necessary to elucidate its precise functions and potential uses.

Formula: C₁₇H₂₅N₃O₅

InChI: InChI=1S/C17H25N3O5/c1-12(15(21)20-14(16(22)23)9-5-6-10-18)19-17(24)25-11-13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11,18H2,1H3,(H,19,24)(H,20,21)(H,22,23)/t12-,14-/m0/s1

InChI key: InChIKey=RQMDMYNAXPFMCC-JSGCOSHPSA-N

SMILES: C(OC(N[C@H](C(N[C@@H](CCCCN)C(O)=O)=O)C)=O)C1=CC=CC=C1

Synonyms:

• L-Lysine, N2-[N-[(phenylmethoxy)carbonyl]-L-alanyl]-
• L-Lysine, N-[(phenylmethoxy)carbonyl]-L-alanyl-

Z-Ala-Lys-OH

CAS: 76264-07-8

Formula: C₁₇H₂₅N₃O₅

Purity: 99.0%

Molecular weight: 351.403

Ref: 10-F492970

Z-Ala-Lys-OH

CAS: 76264-07-8

Z-Ala-Lys-OH is a synthetic amino acid that is resistant to proteolytic degradation. It is soluble in water, alcohols, and amides and has a ph profile of 7.5-8.5. Z-Ala-Lys-OH can also be modified by photometric means or by reaction with methyl esters, which may yield an active site. The product has been used in the synthesis of peptides, enzymes, and other organic compounds.

Formula: C₁₇H₂₅N₃O₅

Purity: Min. 95%

Molecular weight: 351.4 g/mol

Ref: 3D-FA48877