CAS 76264-09-0

N-Benzoyl-L-tyrosyl-L-alanine

Description:

N-Benzoyl-L-tyrosyl-L-alanine is a synthetic dipeptide derivative that combines the amino acids tyrosine and alanine, with a benzoyl group attached to the tyrosine residue. This compound is characterized by its unique structure, which includes an aromatic benzoyl moiety that can influence its solubility and biological activity. Typically, such compounds exhibit properties associated with peptides, including potential bioactivity, such as antimicrobial or antioxidant effects, depending on their specific structure and modifications. The presence of the benzoyl group may enhance lipophilicity, allowing for better membrane permeability. N-Benzoyl-L-tyrosyl-L-alanine may also participate in various biochemical interactions, making it of interest in pharmaceutical and biochemical research. Its CAS number, 76264-09-0, allows for precise identification in chemical databases and literature. As with many peptides, stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in its application and study.

Formula: C₁₉H₂₀N₂O₅

InChI: InChI=1S/C19H20N2O5/c1-12(19(25)26)20-18(24)16(11-13-7-9-15(22)10-8-13)21-17(23)14-5-3-2-4-6-14/h2-10,12,16,22H,11H2,1H3,(H,20,24)(H,21,23)(H,25,26)/t12-,16-/m0/s1

InChI key: InChIKey=PSRCBRUPIDLBSA-LRDDRELGSA-N

SMILES: [C@@H](CC1=CC=C(O)C=C1)(NC(=O)C2=CC=CC=C2)C(N[C@H](C(O)=O)C)=O

Synonyms:

• L-Alanine, N-benzoyl-L-tyrosyl-
• L-Alanine, N-(N-benzoyl-L-tyrosyl)-
• N-Benzoyl-L-tyrosyl-L-alanine