CAS 76265-38-8
:gamma-chloronorvaline
Description:
Gamma-chloronorvaline is an organic compound characterized by its structure as a chlorinated derivative of norvaline, an amino acid. It features a chlorine atom substituted at the gamma position relative to the amino group. This modification can influence its biochemical properties and interactions. Gamma-chloronorvaline is known to act as an inhibitor of certain enzymes, particularly those involved in amino acid metabolism, which can have implications in various biological processes. The compound is typically studied in the context of its potential applications in research, particularly in the fields of biochemistry and pharmacology. Its solubility and stability can vary depending on the solvent and conditions, and it may exhibit specific reactivity due to the presence of the chlorine atom. As with many chemical substances, safety precautions should be observed when handling gamma-chloronorvaline, as it may pose health risks if ingested or improperly managed. Overall, its unique structural features make it a compound of interest in scientific research.
Formula:C5H10ClNO2
InChI:InChI=1/C5H10ClNO2/c1-3(6)2-4(7)5(8)9/h3-4H,2,7H2,1H3,(H,8,9)/t3-,4-/m0/s1
Synonyms:- Antibiotic AL-719
- AL-719
- gamma-chloronorvaline
- (4S)-4-Chloro-L-norvaline
- L-Norvaline, 4-chloro-, (4S)-
- γ-Chloronorvaline
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
γ-Chloronorvaline
CAS:γ-Chloronorvaline exhibits antimicrobial activity against Pseudomonas aeruginosa, Serratia, Klebsiella pneumoniae, and Bacillus subtilis in synthetic media, while it shows no effect on Escherichia coli.Formula:C5H10ClNO2Color and Shape:SolidMolecular weight:151.591
