CymitQuimica logo

CAS 76265-48-0

:

(1Z,3R,7S,8aS,10aR,11R,12R,13R,14R,14aS)-12,14-dihydroxy-4-[(1R)-1-hydroxyethyl]-7-methoxy-1,3,13-trimethyl-3,4,8,8a,10a,11,12,13,14,14a-decahydro-11,14b-epoxynaphtho[2,1-e]oxecin-6(7H)-one

Description:
The chemical substance with the name "(1Z,3R,7S,8aS,10aR,11R,12R,13R,14R,14aS)-12,14-dihydroxy-4-[(1R)-1-hydroxyethyl]-7-methoxy-1,3,13-trimethyl-3,4,8,8a,10a,11,12,13,14,14a-decahydro-11,14b-epoxynaphtho[2,1-e]oxecin-6(7H)-one" and CAS number "76265-48-0" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a naphthoquinone core structure, which is indicative of its potential biological activity. The presence of multiple hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The methoxy group contributes to its overall hydrophobic character, while the epoxide moiety may provide sites for further chemical reactivity. This compound is likely to be of interest in medicinal chemistry due to its structural complexity and potential pharmacological properties, possibly acting as a natural product or derivative with therapeutic applications. Its stereochemical configuration indicates specific spatial arrangements that could affect its interaction with biological targets.
Formula:C23H34O7
InChI:InChI=1/C23H34O7/c1-10-8-11(2)23-14(9-16(28-5)22(27)29-20(10)13(4)24)6-7-15-17(23)18(25)12(3)19(26)21(15)30-23/h6-8,10,12-21,24-26H,9H2,1-5H3/b11-8-/t10-,12-,13-,14-,15-,16+,17+,18-,19-,20?,21-,23?/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.