CymitQuimica logo

CAS 7627-80-7

:

Tetrafluoropyridazine

Description:
Tetrafluoropyridazine is a chemical compound characterized by its unique structure, which consists of a pyridazine ring substituted with four fluorine atoms. This compound is typically colorless to pale yellow and is known for its high stability and low reactivity due to the presence of electronegative fluorine atoms, which enhance its resistance to nucleophilic attack. Tetrafluoropyridazine is often utilized in various chemical applications, including as a building block in the synthesis of more complex organic molecules and in the development of agrochemicals and pharmaceuticals. Its physical properties include a relatively low boiling point and moderate solubility in organic solvents, making it suitable for various chemical reactions. Additionally, the presence of fluorine atoms imparts unique electronic properties, which can influence the compound's behavior in chemical reactions and interactions with other substances. Safety precautions should be taken when handling tetrafluoropyridazine, as with many fluorinated compounds, due to potential toxicity and environmental concerns.
Formula:C4F4N2
InChI:InChI=1/C4F4N2/c5-1-2(6)4(8)10-9-3(1)7
SMILES:c1(c(c(F)nnc1F)F)F
Synonyms:
  • Pyridazine, tetrafluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.