CymitQuimica logo

CAS 76280-60-9

:

Benzenemethanol, 3,5-bis(methoxymethoxy)-

Description:
Benzenemethanol, 3,5-bis(methoxymethoxy)-, also known by its CAS number 76280-60-9, is an organic compound characterized by its aromatic structure and the presence of methoxy groups. This compound features a benzene ring substituted with a benzylic alcohol group and two methoxymethoxy groups at the 3 and 5 positions. The methoxy groups enhance its solubility in organic solvents and can influence its reactivity and interaction with other chemical species. Typically, compounds of this nature exhibit properties such as moderate volatility and potential applications in organic synthesis, as well as in the development of pharmaceuticals or agrochemicals. The presence of multiple methoxy groups can also affect the compound's polarity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting biological activities, although specific studies would be required to elucidate its pharmacological properties. Overall, benzenemethanol derivatives are of significant interest in both industrial and research settings due to their versatile chemical behavior.
Formula:C11H16O5
InChI:InChI=1S/C11H16O5/c1-13-7-15-10-3-9(6-12)4-11(5-10)16-8-14-2/h3-5,12H,6-8H2,1-2H3
InChI key:QZORVGYVDDOQNT-UHFFFAOYSA-N
SMILES:COCOC1=CC(=CC(=C1)CO)OCOC
Found 4 products.