CAS 76287-54-2

4-Bromo-α-butylbenzenemethanol

Description:

4-Bromo-α-butylbenzenemethanol, identified by its CAS number 76287-54-2, is an organic compound characterized by the presence of a bromine atom, a butyl group, and a hydroxymethyl group attached to a benzene ring. This compound features a bromobenzene structure, where the bromine substituent is located at the para position relative to the hydroxymethyl group. The butyl group contributes to its hydrophobic characteristics, while the hydroxymethyl group introduces polarity, making the compound partially soluble in water. The presence of the bromine atom can influence the compound's reactivity, particularly in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure. As with many organic compounds, safety precautions should be taken when handling 4-Bromo-α-butylbenzenemethanol due to potential toxicity and environmental impact.

Formula: C₁₁H₁₅BrO

InChI: InChI=1S/C11H15BrO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8,11,13H,2-4H2,1H3

InChI key: InChIKey=YEQYKXAXIPLBSH-UHFFFAOYSA-N

SMILES: C(CCCC)(O)C1=CC=C(Br)C=C1

Synonyms:

• Benzyl alcohol, p-bromo-α-butyl-
• Benzenemethanol, 4-bromo-α-butyl-
• 4-Bromo-α-butylbenzenemethanol
• 1-(4-Bromophenyl)-1-pentanol