
CAS 76298-89-0
:2-Bromo-N-[1-[4-[[2-hydroxy-3-[2-(2-propen-1-yl)phenoxy]propyl]amino]-4-methylcyclohexyl]-1-methylethyl]acetamide
Description:
2-Bromo-N-[1-[4-[[2-hydroxy-3-[2-(2-propen-1-yl)phenoxy]propyl]amino]-4-methylcyclohexyl]-1-methylethyl]acetamide, with CAS number 76298-89-0, is a complex organic compound characterized by its unique structural features. It contains a bromine atom, which contributes to its reactivity and potential applications in various chemical reactions. The presence of a hydroxy group indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with biological systems. The compound also features a cyclohexyl ring, which can affect its steric properties and overall conformation. Additionally, the presence of an acetamide functional group suggests potential for biological activity, possibly as a pharmaceutical agent. Its intricate structure, including multiple functional groups, may allow for diverse interactions in chemical and biological contexts. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C24H37BrN2O3
InChI:InChI=1S/C24H37BrN2O3/c1-5-8-18-9-6-7-10-21(18)30-17-20(28)16-26-24(4)13-11-19(12-14-24)23(2,3)27-22(29)15-25/h5-7,9-10,19-20,26,28H,1,8,11-17H2,2-4H3,(H,27,29)
InChI key:InChIKey=UAXZWLFRPNDCMX-UHFFFAOYSA-N
SMILES:C(NC(CBr)=O)(C)(C)C1CCC(NCC(COC2=C(CC=C)C=CC=C2)O)(C)CC1
Synonyms:- Acetamide, 2-bromo-N-[1-[4-[[2-hydroxy-3-[2-(2-propenyl)phenoxy]propyl]amino]-4-methylcyclohexyl]-1-methylethyl]-
- Acetamide, 2-bromo-N-[1-[4-[[2-hydroxy-3-[2-(2-propen-1-yl)phenoxy]propyl]amino]-4-methylcyclohexyl]-1-methylethyl]-
- 2-Bromo-N-[1-[4-[[2-hydroxy-3-[2-(2-propen-1-yl)phenoxy]propyl]amino]-4-methylcyclohexyl]-1-methylethyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BrAAM
CAS:<p>1-(2-Allylphenoxy)-3-((8-bromoacetylamino-4-menthane-1-yl)amino)-1-propanol is a bioactive chemical.</p>Formula:C24H37BrN2O3Color and Shape:SolidMolecular weight:481.47
