CAS 76299-95-1
:N-(4'-fluorobiphenyl-4-yl)-N-hydroxyacetamide
Description:
N-(4'-fluorobiphenyl-4-yl)-N-hydroxyacetamide, with the CAS number 76299-95-1, is an organic compound characterized by its unique structural features, including a biphenyl moiety substituted with a fluorine atom and a hydroxyacetamide functional group. This compound typically exhibits properties associated with both aromatic and amide functionalities, which can influence its solubility, reactivity, and potential biological activity. The presence of the fluorine atom may enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. As a hydroxyacetamide, it may participate in hydrogen bonding, which can be significant in biological systems and in the formation of complexes with other molecules. The compound's characteristics make it of interest in medicinal chemistry and materials science, where it may be explored for applications such as drug development or as a building block in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise values.
Formula:C14H12FNO2
InChI:InChI=1/C14H12FNO2/c1-10(17)16(18)14-8-4-12(5-9-14)11-2-6-13(15)7-3-11/h2-9,18H,1H3
SMILES:CC(=O)N(c1ccc(cc1)c1ccc(cc1)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.