CAS 763-33-7
:(2E)-3-Amino-2-butenenitrile
Description:
(2E)-3-Amino-2-butenenitrile, with the CAS number 763-33-7, is an organic compound characterized by its unique structure, which includes an amino group and a nitrile functional group. This compound features a double bond between the second and third carbon atoms, contributing to its classification as an unsaturated nitrile. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. (2E)-3-Amino-2-butenenitrile is of interest in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by both the nitrile and amino functionalities, making it a versatile building block in synthetic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H6N2
InChI:InChI=1S/C4H6N2/c1-4(6)2-3-5/h2H,6H2,1H3/b4-2+
InChI key:InChIKey=DELJOESCKJGFML-DUXPYHPUSA-N
SMILES:C(=C(\C)/N)\C#N
Synonyms:- 2-Butenenitrile, 3-amino-, (2E)-
- (E)-3-Aminobut-2-enenitrile
- Crotononitrile, 3-amino-, (E)-
- (2E)-3-Amino-2-butenenitrile
- 2-Butenenitrile, 3-amino-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.