CAS 763-35-9
:3-Mercaptopropanamide
Description:
3-Mercaptopropanamide, with the CAS number 763-35-9, is an organic compound characterized by the presence of both a thiol (-SH) and an amide (-C(O)NH2) functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and polar organic solvents, which is attributed to the polar nature of the amide group. The thiol group imparts distinct reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and the formation of disulfide bonds. 3-Mercaptopropanamide is often used in organic synthesis and as a building block in the preparation of more complex molecules. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. However, like many thiol-containing compounds, it can be sensitive to oxidation and may require careful handling to maintain its stability and reactivity.
Formula:C3H7NOS
InChI:InChI=1S/C3H7NOS/c4-3(5)1-2-6/h6H,1-2H2,(H2,4,5)
InChI key:InChIKey=JLSJEUQOXVVCPN-UHFFFAOYSA-N
SMILES:C(C(N)=O)CS
Synonyms:- 3-Mercaptopropanamide
- 3-Mercaptopropionamide
- Propanamide, 3-Mercapto-
- Propionamide, 3-mercapto-
- β-Mercaptopropionamide
- 3-Sulfanylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Mercaptopropanamide
CAS:Controlled ProductFormula:C3H7NOSColor and Shape:NeatMolecular weight:105.159

