CAS 76301-00-3
:methyl 3-(trimethoxysilyl)propanoate
Description:
Methyl 3-(trimethoxysilyl)propanoate, with the CAS number 76301-00-3, is an organosilicon compound characterized by its silane functional group, which enhances its reactivity and compatibility with various substrates. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. It features a methyl ester group, which contributes to its reactivity in condensation reactions, making it useful in applications such as surface modification and adhesion promotion. The trimethoxysilyl group allows for the formation of siloxane bonds upon hydrolysis, facilitating the attachment to siliceous surfaces, which is beneficial in coatings, sealants, and composite materials. Additionally, this compound can improve the mechanical properties and durability of materials by enhancing interfacial adhesion. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may release methanol upon hydrolysis. Overall, methyl 3-(trimethoxysilyl)propanoate is valued in various industrial applications for its unique chemical properties and functional versatility.
Formula:C7H16O5Si
InChI:InChI=1/C7H16O5Si/c1-9-7(8)5-6-13(10-2,11-3)12-4/h5-6H2,1-4H3
SMILES:COC(=O)CC[Si](OC)(OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
