CAS 76301-91-2

6-Chloro-3,4-dihydro-8-methyl-2H-1-benzopyran-4-carboxylic acid

Description:

6-Chloro-3,4-dihydro-8-methyl-2H-1-benzopyran-4-carboxylic acid, with the CAS number 76301-91-2, is a chemical compound that belongs to the class of benzopyran derivatives. This substance features a benzopyran core, which is characterized by a fused benzene and pyran ring structure. The presence of a chloro group at the 6-position and a carboxylic acid functional group at the 4-position contributes to its reactivity and potential biological activity. The methyl group at the 8-position may influence its solubility and interaction with biological systems. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and antioxidant activities. Its structural features suggest that it may participate in various chemical reactions, making it a candidate for further research in drug development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.

Formula: C₁₁H₁₁ClO₃

InChI: InChI=1S/C11H11ClO3/c1-6-4-7(12)5-9-8(11(13)14)2-3-15-10(6)9/h4-5,8H,2-3H2,1H3,(H,13,14)

InChI key: InChIKey=OGGDBJFRSNHLRE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2C(=C(C)C=C(Cl)C2)OCC1

Synonyms:

• 2H-1-Benzopyran-4-carboxylic acid, 6-chloro-3,4-dihydro-8-methyl-
• 6-Chloro-3,4-dihydro-8-methyl-2H-1-benzopyran-4-carboxylic acid
• 6-Chloro-8-methylchroman-4-carboxylic acid