CAS 76304-46-6
:3-(2-bromophenyl)-1H-pyrrole
Description:
3-(2-Bromophenyl)-1H-pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromophenyl group at the 3-position of the pyrrole ring introduces significant electronic and steric effects, influencing the compound's reactivity and properties. This compound typically exhibits moderate solubility in organic solvents due to its aromatic nature, while its bromine substituent can participate in various chemical reactions, such as nucleophilic substitution or cross-coupling reactions. The compound may also display interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure contributes to its potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 3-(2-bromophenyl)-1H-pyrrole is a versatile compound with unique properties that can be leveraged in various chemical applications.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c11-10-4-2-1-3-9(10)8-5-6-12-7-8/h1-7,12H
Synonyms:- 3-(2-Bromphenyl)-1H-pyrrol
- 1H-pyrrole, 3-(2-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.