CAS 763073-51-4

(R)-3-Amino-4-(4-fluorophenyl)butyric acid

Description:

(R)-3-Amino-4-(4-fluorophenyl)butyric acid, also known as a selective modulator of the GABA receptor, is an amino acid derivative characterized by its chiral center, which contributes to its specific biological activity. This compound features an amino group, a carboxylic acid group, and a phenyl ring substituted with a fluorine atom, which influences its pharmacological properties. The presence of the fluorine atom enhances lipophilicity and may affect the compound's interaction with biological targets. It is typically used in research related to neurological disorders, particularly for its potential role in modulating neurotransmitter systems. The compound is soluble in polar solvents, and its stability can be influenced by pH and temperature. As with many amino acids, it can exist in different ionic forms depending on the pH of the solution. Safety and handling precautions are essential, as with any chemical substance, to mitigate potential hazards during laboratory use.

Formula: C₁₀H₁₂FNO₂

InChI: InChI=1/C10H12FNO2/c11-8-3-1-7(2-4-8)5-9(12)6-10(13)14/h1-4,9H,5-6,12H2,(H,13,14)/t9-/m1/s1

SMILES: c1cc(ccc1C[C@H](CC(=O)O)N)F

Synonyms:

• (3R)-3-Amino-4-(4-fluorophenyl)butanoic acid
• benzenebutanoic acid, beta-amino-4-fluoro-, (betaR)-