CAS 763105-70-0
:2,2,2-Trifluoroacetic acid (2Z)-2-(2-piperazinylidene)hydrazide
Description:
2,2,2-Trifluoroacetic acid (2Z)-2-(2-piperazinylidene)hydrazide is a chemical compound characterized by its unique structure, which includes a trifluoroacetic acid moiety and a hydrazide functional group linked to a piperazine ring. This compound typically exhibits properties associated with both hydrazides and fluorinated carboxylic acids, such as increased acidity due to the presence of the trifluoroacetyl group. The trifluoromethyl groups contribute to its lipophilicity and can enhance biological activity, making it of interest in pharmaceutical research. The piperazine ring may impart additional pharmacological properties, including potential interactions with biological targets. The compound is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, while the fluorinated portion may influence its reactivity and stability. Overall, 2,2,2-Trifluoroacetic acid (2Z)-2-(2-piperazinylidene)hydrazide represents a versatile structure with potential applications in medicinal chemistry and materials science.
Formula:C6H9F3N4O
InChI:InChI=1S/C6H9F3N4O/c7-6(8,9)5(14)13-12-4-3-10-1-2-11-4/h10H,1-3H2,(H,11,12)(H,13,14)
InChI key:InChIKey=RKIDLJBEMIARHI-UHFFFAOYSA-N
SMILES:N(\NC(C(F)(F)F)=O)=C\1/CNCCN1
Synonyms:- 2,2,2-Trifluoro-N′-(1,2,3,6-tetrahydropyrazin-5-yl)acetohydrazide
- 2,2,2-Trifluoroacetic acid (2Z)-2-(2-piperazinylidene)hydrazide
- Acetic acid, 2,2,2-trifluoro-, (2Z)-2-(2-piperazinylidene)hydrazide
- Acetic acid, trifluoro-, (2Z)-2-(2-piperazinylidene)hydrazide
- N'-[(2Z)-Piperazin-2-ylidene]trifluoroacetohydrazide
- N-[(2Z)-Piperazin-2-ylidene]-2,2,2-trifluoroacetohydrazide
- Trifluoroacetic Acid (2Z)-Piperazinylidenehydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
