CymitQuimica logo

CAS 763109-04-2

:

2-[4-Fluoro-2-(5-isoxazolyl)phenoxy]acetic acid

Description:
2-[4-Fluoro-2-(5-isoxazolyl)phenoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a phenoxy group and an isoxazole ring. This compound features a fluorine atom substituted on the aromatic ring, enhancing its biological activity and potential applications in pharmaceuticals. The presence of the isoxazole moiety contributes to its chemical reactivity and may influence its interaction with biological targets. As an acetic acid derivative, it possesses acidic properties, which can affect its solubility and stability in various solvents. The compound is typically studied for its potential use in agrochemicals or medicinal chemistry, where its specific interactions with biological systems can be explored. Its CAS number, 763109-04-2, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound exemplifies the complexity and diversity of organic molecules used in scientific research and development.
Formula:C11H8FNO4
InChI:InChI=1S/C11H8FNO4/c12-7-1-2-9(16-6-11(14)15)8(5-7)10-3-4-13-17-10/h1-5H,6H2,(H,14,15)
InChI key:InChIKey=PJHKJGBSUVCXJB-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(C=C(F)C=C1)C2=CC=NO2
Synonyms:
  • 2-[4-Fluoro-2-(5-isoxazolyl)phenoxy]acetic acid
  • Acetic acid, 2-[4-fluoro-2-(5-isoxazolyl)phenoxy]-
  • Acetic acid, [4-fluoro-2-(5-isoxazolyl)phenoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.