CymitQuimica logo

CAS 763109-07-5

:

Ethyl 5-amino-4-(4-methoxyphenyl)-3-isoxazolecarboxylate

Description:
Ethyl 5-amino-4-(4-methoxyphenyl)-3-isoxazolecarboxylate is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group enhances its potential for hydrogen bonding and may influence its biological activity. The para-methoxyphenyl substituent adds to its structural complexity and can affect its electronic properties, potentially impacting its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its structural motifs, which are often associated with various pharmacological activities. Its CAS number, 763109-07-5, allows for precise identification in chemical databases and literature. Overall, the combination of functional groups and the isoxazole framework suggests that this compound could exhibit unique chemical behavior and potential applications in drug development or as a research tool in various fields of chemistry and biology.
Formula:C13H14N2O4
InChI:InChI=1S/C13H14N2O4/c1-3-18-13(16)11-10(12(14)19-15-11)8-4-6-9(17-2)7-5-8/h4-7H,3,14H2,1-2H3
InChI key:InChIKey=VIORUJOIJJXREO-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(=C(N)ON1)C2=CC=C(OC)C=C2
Synonyms:
  • 3-Isoxazolecarboxylic acid, 5-amino-4-(4-methoxyphenyl)-, ethyl ester
  • Ethyl 5-amino-4-(4-methoxyphenyl)-3-isoxazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.