CymitQuimica logo

CAS 763109-60-0

:

5-(4-Fluorophenyl)-3-isoxazolecarboxylic acid hydrazide

Description:
5-(4-Fluorophenyl)-3-isoxazolecarboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include an isoxazole ring and a hydrazide functional group. The presence of the 4-fluorophenyl moiety contributes to its potential biological activity and lipophilicity. This compound typically exhibits moderate solubility in polar solvents, which can be attributed to the hydrazide group that can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the isoxazole's role in various biological activities. The compound may also exhibit specific reactivity patterns typical of hydrazides, such as forming hydrazones or undergoing oxidation. Additionally, the fluorine atom can influence the electronic properties and metabolic stability of the compound, making it an interesting candidate for further research in drug design and development. As with many chemical substances, safety and handling precautions should be observed, given the potential reactivity and toxicity associated with hydrazides and halogenated compounds.
Formula:C10H8FN3O2
InChI:InChI=1S/C10H8FN3O2/c11-7-3-1-6(2-4-7)9-5-8(14-16-9)10(15)13-12/h1-5H,12H2,(H,13,15)
InChI key:InChIKey=FANDPJDQVOQOBO-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C=C(ON1)C2=CC=C(F)C=C2
Synonyms:
  • 3-Isoxazolecarboxylic acid, 5-(4-fluorophenyl)-, hydrazide
  • 5-(4-Fluorophenyl)-3-isoxazolecarboxylic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.