CAS 763120-64-5

Boronic acid, [3-(dimethylamino)-1-propynyl]-

Description:

Boronic acid, [3-(dimethylamino)-1-propynyl]-, identified by CAS number 763120-64-5, is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a propynyl chain that includes a dimethylamino substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The dimethylamino group enhances its nucleophilicity and solubility in organic solvents, while the propynyl moiety can participate in further chemical reactions, such as cross-coupling reactions. Boronic acids are also known for their role in the development of sensors and in the field of materials science. Overall, this compound's unique structure allows it to serve as a versatile building block in the synthesis of more complex molecules.

Formula: C₅H₁₀BNO₂

InChI: InChI=1S/C5H10BNO2/c1-7(2)5-3-4-6(8)9/h8-9H,5H2,1-2H3

InChI key: InChIKey=BBMZVOFMOVWMFI-UHFFFAOYSA-N

SMILES: C(#CB(O)O)CN(C)C

Synonyms:

• [3-(Dimethylamino)prop-1-yn-1-yl]boronic acid
• Boronic acid, [3-(dimethylamino)-1-propynyl]- (9CI)
• Boronic acid, [3-(dimethylamino)-1-propynyl]-

(3-(Dimethylamino)prop-1-yn-1-yl)boronic acid

CAS: 763120-64-5

Formula: C₅H₁₀BNO₂

Molecular weight: 126.9494

Ref: IN-DA0056EO