CAS 763122-73-2

tert-butyl N-[(1S)-1-(hydroxymethyl)but-3-ynyl]carbamate

Description:

Tert-butyl N-[(1S)-1-(hydroxymethyl)but-3-ynyl]carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of a carbamic acid with an alcohol. This compound features a tert-butyl group, providing steric hindrance and influencing its solubility and reactivity. The presence of a hydroxymethyl group and a but-3-ynyl moiety indicates that it has potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The stereochemistry of the (1S) configuration suggests specific spatial arrangements that can affect biological activity and interactions with enzymes or receptors. Additionally, the compound's structure may confer unique properties such as stability under certain conditions and reactivity towards nucleophiles or electrophiles. Overall, tert-butyl N-[(1S)-1-(hydroxymethyl)but-3-ynyl]carbamate is a versatile compound with potential utility in various chemical applications, particularly in the synthesis of more complex molecules.

Formula: C₁₀H₁₇NO₃

InChI: InChI=1/C10H17NO3/c1-5-6-8(7-12)11-9(13)14-10(2,3)4/h1,8,12H,6-7H2,2-4H3,(H,11,13)/t8-/m0/s1

SMILES: C#CC[C@@H](CO)N=C(O)OC(C)(C)C

Carbamic acid, [(1S)-1-(hydroxymethyl)-3-butynyl]-, 1,1-dimethylethyl ester

CAS: 763122-73-2

Formula: C₁₀H₁₇NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 199.2469

Ref: IN-DA005E6V

tert-Butyl(S)-(1-hydroxypent-4-yn-2-yl)carbamate

CAS: 763122-73-2

tert-Butyl(S)-(1-hydroxypent-4-yn-2-yl)carbamate

Purity: 96%

Molecular weight: 199.25g/mol

Ref: 54-OR1006476

Boc-2-propargyl-L-glycinol

CAS: 763122-73-2

Boc-2-propargyl-L-glycinol is a chemical building block that is useful for the synthesis of complex compounds. It has been used as a reagent and reaction component due to its high quality, versatility, and usefulness in research. Boc-2-propargyl-L-glycinol can be used as a speciality chemical or a versatile building block for the synthesis of complex compounds.

Formula: C₁₀H₁₇NO₃

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 199.25 g/mol

Ref: 3D-NFB12273

BOC-2-PROPARGYL-L-GLYCINOL

CAS: 763122-73-2

Formula: C₁₀H₁₇NO₃

Purity: 96%

Molecular weight: 199.25

Ref: 10-F302674