
CAS 763124-72-7
:4-Phenyl-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]-1-piperazineacetamide
Description:
4-Phenyl-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]-1-piperazineacetamide is a chemical compound characterized by its complex structure, which includes a piperazine ring, a phenyl group, and a triazole moiety. This compound is typically classified as a piperazine derivative and may exhibit various biological activities, potentially making it of interest in pharmaceutical research. The presence of the triazole ring suggests possible interactions with biological targets, as triazoles are known for their role in medicinal chemistry, particularly in antifungal and antimicrobial agents. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may also affect its pharmacokinetic properties. Additionally, the specific arrangement of substituents can lead to unique interactions with receptors or enzymes, making it a candidate for further investigation in drug development. As with many synthetic compounds, understanding its characteristics requires comprehensive studies, including spectroscopic analysis and biological assays, to elucidate its potential applications and mechanisms of action.
Formula:C20H22N6O
InChI:InChI=1S/C20H22N6O/c27-20(23-17-6-8-19(9-7-17)26-16-21-15-22-26)14-24-10-12-25(13-11-24)18-4-2-1-3-5-18/h1-9,15-16H,10-14H2,(H,23,27)
InChI key:InChIKey=ZUAVKSQYPBOFKR-UHFFFAOYSA-N
SMILES:N(C(CN1CCN(CC1)C2=CC=CC=C2)=O)C3=CC=C(C=C3)N4C=NC=N4
Synonyms:- 1-Piperazineacetamide, 4-phenyl-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]-
- 4-Phenyl-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]-1-piperazineacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.