
CAS 763130-54-7
:N-[(5-Bromo-2-methoxyphenyl)methyl]-N-[4-(1-methylethyl)phenyl]-N′-phenylthiourea
Description:
N-[(5-Bromo-2-methoxyphenyl)methyl]-N-[4-(1-methylethyl)phenyl]-N′-phenylthiourea, with CAS number 763130-54-7, is a synthetic organic compound characterized by its thiourea functional group, which is known for its diverse biological activities. This compound features a complex structure that includes a bromo-substituted methoxyphenyl moiety and an isopropyl-substituted phenyl group, contributing to its potential lipophilicity and reactivity. The presence of the thiourea group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as thioureas are often involved in enzyme inhibition and other biological interactions. The compound's unique substituents may influence its solubility, stability, and interaction with biological targets. Additionally, the bromine atom can serve as a site for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, this compound exemplifies the complexity and versatility of thiourea derivatives in chemical research and applications.
Formula:C24H25BrN2OS
InChI:InChI=1S/C24H25BrN2OS/c1-17(2)18-9-12-22(13-10-18)27(24(29)26-21-7-5-4-6-8-21)16-19-15-20(25)11-14-23(19)28-3/h4-15,17H,16H2,1-3H3,(H,26,29)
InChI key:InChIKey=MJSOQAJPLMZPDS-UHFFFAOYSA-N
SMILES:N(CC1=C(OC)C=CC(Br)=C1)(C(NC2=CC=CC=C2)=S)C3=CC=C(C(C)C)C=C3
Synonyms:- Thiourea, N-[(5-bromo-2-methoxyphenyl)methyl]-N-[4-(1-methylethyl)phenyl]-N′-phenyl-
- N-[(5-Bromo-2-methoxyphenyl)methyl]-N-[4-(1-methylethyl)phenyl]-N′-phenylthiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.