CymitQuimica logo

CAS 763130-57-0

:

5-Methoxy-2-[[(4-phenoxyphenyl)amino]methyl]phenol

Description:
5-Methoxy-2-[[(4-phenoxyphenyl)amino]methyl]phenol, with the CAS number 763130-57-0, is an organic compound characterized by its complex structure, which includes a methoxy group, a phenol moiety, and an amino group linked to a phenoxyphenyl group. This compound typically exhibits properties associated with phenolic compounds, such as potential antioxidant activity and the ability to participate in hydrogen bonding due to the presence of hydroxyl (-OH) groups. Its molecular structure suggests it may have applications in pharmaceuticals or as a chemical intermediate, particularly in the synthesis of more complex organic molecules. The presence of both methoxy and phenoxy groups can influence its solubility and reactivity, making it a subject of interest in medicinal chemistry. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties and potential therapeutic uses. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C20H19NO3
InChI:InChI=1S/C20H19NO3/c1-23-19-10-7-15(20(22)13-19)14-21-16-8-11-18(12-9-16)24-17-5-3-2-4-6-17/h2-13,21-22H,14H2,1H3
InChI key:InChIKey=JLUDJRSLAFLJRH-UHFFFAOYSA-N
SMILES:O(C1=CC=C(NCC2=C(O)C=C(OC)C=C2)C=C1)C3=CC=CC=C3
Synonyms:
  • Phenol, 5-methoxy-2-[[(4-phenoxyphenyl)amino]methyl]-
  • 5-Methoxy-2-[[(4-phenoxyphenyl)amino]methyl]phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.