CymitQuimica logo

CAS 763131-37-9

:

4-Bromo-2-[[[4-(1-methylethyl)phenyl]amino]methyl]phenol

Description:
4-Bromo-2-[[[4-(1-methylethyl)phenyl]amino]methyl]phenol, identified by its CAS number 763131-37-9, is an organic compound characterized by its complex structure, which includes a bromine atom, a phenolic hydroxyl group, and an isopropyl-substituted aniline moiety. This compound typically exhibits properties associated with both aromatic amines and phenols, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine substituent. The bromine atom can influence the compound's electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the presence of the isopropyl group may enhance lipophilicity, affecting its biological activity and interaction with other molecules. This compound may be of interest in pharmaceutical research or materials science due to its unique structural features, which could impart specific functionalities or biological activities. However, detailed studies on its toxicity, stability, and reactivity would be necessary to fully understand its potential applications and safety profile.
Formula:C16H18BrNO
InChI:InChI=1S/C16H18BrNO/c1-11(2)12-3-6-15(7-4-12)18-10-13-9-14(17)5-8-16(13)19/h3-9,11,18-19H,10H2,1-2H3
InChI key:InChIKey=WLZCSKSUZOUBQZ-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C(C)C)C=C1)C2=C(O)C=CC(Br)=C2
Synonyms:
  • Phenol, 4-bromo-2-[[[4-(1-methylethyl)phenyl]amino]methyl]-
  • 4-Bromo-2-[[[4-(1-methylethyl)phenyl]amino]methyl]phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.