CymitQuimica logo

CAS 76325-64-9

:

3-hydroxy-1-methyl-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one

Description:
3-Hydroxy-1-methyl-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one, with the CAS number 76325-64-9, is a chemical compound that belongs to the class of indole derivatives. This substance features a dihydroindole structure, characterized by the presence of a hydroxyl group and a ketone moiety, which contribute to its reactivity and potential biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 3-hydroxy-1-methyl-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one represents a unique structure with potential implications in chemical and biological research.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c1-8(14)7-12(16)9-5-3-4-6-10(9)13(2)11(12)15/h3-6,16H,7H2,1-2H3
Synonyms:
  • 2H-Indol-2-one, 1,3-dihydro-3-hydroxy-1-methyl-3-(2-oxopropyl)-
  • 3-HYDROXY-1-METHYL-3-(2-OXOPROPYL)-1,3-DIHYDRO-2H-INDOL-2-ONE
  • 3-HYDROXY-1-METHYL-3-(2-OXO-PROPYL)-1,3-DIHYDRO-INDOL-2-ONE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.