CAS 76325-66-1

5-Bromo-1,3-dihydro-3-hydroxy-3-(2-oxopropyl)-2H-indol-2-one

Description:

5-Bromo-1,3-dihydro-3-hydroxy-3-(2-oxopropyl)-2H-indol-2-one, with the CAS number 76325-66-1, is a chemical compound that belongs to the indole family, characterized by its unique bicyclic structure. This compound features a bromine atom, which contributes to its reactivity and potential biological activity. The presence of a hydroxyl group indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. The 2-oxopropyl substituent suggests potential for further chemical transformations and reactivity, making it of interest in synthetic organic chemistry. Additionally, compounds of this type may exhibit pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would need to be referenced for detailed insights. Its molecular structure and functional groups suggest that it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Overall, this compound represents a fascinating area of study within medicinal chemistry and organic synthesis.

Formula: C₁₁H₁₀BrNO₃

InChI: InChI=1S/C11H10BrNO3/c1-6(14)5-11(16)8-4-7(12)2-3-9(8)13-10(11)15/h2-4,16H,5H2,1H3,(H,13,15)

InChI key: InChIKey=JIEOWMKDHNNNHF-UHFFFAOYSA-N

SMILES: C(C(C)=O)C1(O)C=2C(NC1=O)=CC=C(Br)C2

Synonyms:

• 5-Bromo-1,3-dihydro-3-hydroxy-3-(2-oxopropyl)-2H-indol-2-one
• 2H-Indol-2-one, 5-bromo-1,3-dihydro-3-hydroxy-3-(2-oxopropyl)-
• NSC 294553