CAS 76325-79-6
:3-hydroxy-3-(2-oxocyclohexyl)-1,3-dihydro-2H-indol-2-one
Description:
3-Hydroxy-3-(2-oxocyclohexyl)-1,3-dihydro-2H-indol-2-one, with the CAS number 76325-79-6, is a chemical compound that belongs to the class of indole derivatives. This substance features a bicyclic structure that includes an indole moiety, which is characterized by a fused benzene and pyrrole ring. The presence of a hydroxyl group (-OH) and a ketone group (C=O) contributes to its reactivity and potential biological activity. The cyclohexyl ring adds to the compound's steric properties, influencing its interactions with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many organic compounds, it is essential to handle it with care, considering safety protocols due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C14H15NO3
InChI:InChI=1/C14H15NO3/c16-12-8-4-2-6-10(12)14(18)9-5-1-3-7-11(9)15-13(14)17/h1,3,5,7,10,18H,2,4,6,8H2,(H,15,17)
Synonyms:- 2H-Indol-2-one,1,3-dihydro-3-hydroxy-3-(2-oxocyclohexyl)-
- 3-hydroxy-3-(2-oxocyclohexyl)-1H-indol-2-one
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.