CAS 76326-99-3
:N,N-Dimethylglucamine
Description:
N,N-Dimethylglucamine is an organic compound characterized by its structure as a glucamine derivative, featuring two methyl groups attached to the nitrogen atom of the amino group. It is a colorless to pale yellow liquid that is hygroscopic and soluble in water, which makes it useful in various applications, particularly in pharmaceuticals and biochemistry. The compound exhibits basic properties due to the presence of the amino group, allowing it to form salts with acids. N,N-Dimethylglucamine is often utilized as a reagent in chemical synthesis and as a stabilizing agent in formulations. Its ability to form complexes with metal ions enhances its utility in analytical chemistry. Additionally, it is known for its low toxicity, making it suitable for use in biological systems. Overall, N,N-Dimethylglucamine is valued for its versatility and effectiveness in diverse chemical and industrial applications.
Formula:C8H19NO5
InChI:InChI=1S/C8H19NO5/c1-9(2)3-5(11)7(13)8(14)6(12)4-10/h5-8,10-14H,3-4H2,1-2H3/t5-,6+,7+,8+/m0/s1
InChI key:InChIKey=CUGDYSSBTWBKII-LXGUWJNJSA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)([C@H](CN(C)C)O)O
Synonyms:- N,N-Dimethyl-D-glucamine
- N,N-Dimethylglucamine
- 1-Deoxy-1-(dimethylamino)-D-glucitol
- D-Glucitol, 1-deoxy-1-(dimethylamino)-
- Genamin Gluco 50
- (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentaol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N,N-Dimethyl-D-glucamine-d3
CAS:Controlled ProductFormula:C8D3H16NO5Color and Shape:NeatMolecular weight:212.259

