CAS 76327-33-8

Benzoyl chloride, 3-chloro-4-propoxy-

Description:

Benzoyl chloride, 3-chloro-4-propoxy- is an organic compound characterized by the presence of a benzoyl group attached to a chlorine atom and a propoxy substituent. It is typically a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity. This compound is known for its role as an acylating agent in organic synthesis, particularly in the preparation of esters and amides. The presence of the chlorine atom enhances its electrophilic character, making it more reactive towards nucleophiles. Additionally, the propoxy group contributes to its solubility in organic solvents while influencing its overall reactivity and stability. As with many acyl chlorides, it can react vigorously with water, releasing hydrochloric acid and forming the corresponding carboxylic acid. Safety precautions are essential when handling this compound, as it can cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place away from moisture is recommended to maintain its stability and prevent hydrolysis.

Formula: C₁₀H₁₀Cl₂O₂

InChI: InChI=1S/C10H10Cl2O2/c1-2-5-14-9-4-3-7(10(12)13)6-8(9)11/h3-4,6H,2,5H2,1H3

InChI key: InChIKey=NRWDQONAZDVAAJ-UHFFFAOYSA-N

SMILES: O(CCC)C1=C(Cl)C=C(C(Cl)=O)C=C1

Synonyms:

• 3-Chloro-4-propoxy-benzoyl chloride
• Benzoyl chloride, 3-chloro-4-propoxy-
• 3-Chloro-4-n-propoxybenzoyl chloride