
CAS 76334-36-6
:3-bromo-3-buten-1-ol
Description:
3-Bromo-3-buten-1-ol is an organic compound characterized by its structure, which includes a bromine atom and a hydroxyl group attached to a butene backbone. This compound features a double bond between the second and third carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom makes it a useful intermediate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The hydroxyl group indicates that it is an alcohol, which can participate in hydrogen bonding, influencing its solubility and boiling point. Typically, compounds like 3-bromo-3-buten-1-ol are utilized in the synthesis of more complex molecules in pharmaceuticals and agrochemicals. Its reactivity and functional groups make it a valuable building block in organic chemistry. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose health risks. Overall, 3-bromo-3-buten-1-ol is a versatile compound with significant implications in chemical research and industry.
Formula:C4H7BrO
InChI:InChI=1/C4H7BrO/c1-4(5)2-3-6/h6H,1-3H2
SMILES:C=C(CCO)Br
Synonyms:- 3-Bromobut-3-En-1-Ol
- 3-Bromo-2-Buten-1-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-3-buten-1-ol
CAS:3-Bromo-3-buten-1-ol is an alcohol that can be synthesized by the cross-coupling reaction of a terminal alkene and an alkyne. The terminal alkene can be prepared from the reduction of farnesyl diphosphate, which is catalyzed by diphosphate synthase. This reaction can be carried out in high yield with various alcohols. 3-Bromo-3-buten-1-ol has been used as a probe to detect glycosidic carbonyl groups, which are important for the synthesis of steroidal glycosides. It has also been shown to desensitize phosphodiesterases and inhibit the activity of diphosphate, which is needed in many biological processes such as DNA replication and protein synthesis.Formula:C4H7BrOPurity:Min. 98 Area-%Color and Shape:Colorless PowderMolecular weight:151 g/mol



