CymitQuimica logo

CAS 76336-03-3

:

Ethyl 1,2-dihydro-4-hydroxy-7-methyl-2-oxo-1-(phenylmethyl)-1,8-naphthyridine-3-carboxylate

Description:
Ethyl 1,2-dihydro-4-hydroxy-7-methyl-2-oxo-1-(phenylmethyl)-1,8-naphthyridine-3-carboxylate, with the CAS number 76336-03-3, is a chemical compound that belongs to the class of naphthyridine derivatives. This compound typically exhibits a complex molecular structure characterized by a naphthyridine core, which is a bicyclic aromatic system containing nitrogen atoms. The presence of functional groups such as a carboxylate ester and a hydroxyl group contributes to its potential reactivity and solubility properties. Ethyl esters generally have moderate polarity, which can influence their interactions in biological systems. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure that may have applications in various fields, including drug development and organic synthesis.
Formula:C19H18N2O4
InChI:InChI=1S/C19H18N2O4/c1-3-25-19(24)15-16(22)14-10-9-12(2)20-17(14)21(18(15)23)11-13-7-5-4-6-8-13/h4-10,22H,3,11H2,1-2H3
InChI key:InChIKey=GUJUFQXQKVJRKG-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(O)=C(C(OCC)=O)C1=O)=CC=C(C)N2)C3=CC=CC=C3
Synonyms:
  • 1,8-Naphthyridine-3-carboxylic acid, 1,2-dihydro-4-hydroxy-7-methyl-2-oxo-1-(phenylmethyl)-, ethyl ester
  • Ethyl 1,2-dihydro-4-hydroxy-7-methyl-2-oxo-1-(phenylmethyl)-1,8-naphthyridine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.