CAS 76336-24-8
:3-Furanpropanoyl chloride
Description:
3-Furanpropanoyl chloride, with the CAS number 76336-24-8, is an organic compound characterized by its furan ring structure and a propanoyl chloride functional group. This compound is typically a colorless to pale yellow liquid, exhibiting a pungent odor due to the presence of the acyl chloride functional group, which is known for its reactivity. It is soluble in organic solvents such as dichloromethane and ether but is generally not soluble in water. The presence of the furan ring imparts unique chemical properties, making it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. As an acyl chloride, it is highly reactive, especially towards nucleophiles, and can undergo hydrolysis to form the corresponding carboxylic acid. Safety precautions are essential when handling this compound, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from moisture, is also recommended to maintain its stability.
Formula:C7H7ClO2
InChI:InChI=1S/C7H7ClO2/c8-7(9)2-1-6-3-4-10-5-6/h3-5H,1-2H2
InChI key:InChIKey=IKNJIXHYDHCRLC-UHFFFAOYSA-N
SMILES:C(CC(Cl)=O)C=1C=COC1
Synonyms:- 3-Furanpropanoyl chloride
- β-(3-Furyl)propionyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.