CAS 76338-73-3

N-[2-chloro-4-(trifluoromethyl)phenyl]-L-valine

Description:

N-[2-chloro-4-(trifluoromethyl)phenyl]-L-valine, with the CAS number 76338-73-3, is an organic compound that features a valine amino acid structure modified with a chlorinated and trifluoromethyl-substituted phenyl group. This compound is characterized by its unique combination of functional groups, which contribute to its chemical reactivity and potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. The chlorine atom introduces additional reactivity, which may influence interactions with biological targets. As an amino acid derivative, it may participate in various biochemical processes, making it of interest in medicinal chemistry and drug design. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. However, detailed studies on its pharmacokinetics, toxicity, and biological activity would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₂H₁₃ClF₃NO₂

InChI: InChI=1/C12H13ClF3NO2/c1-6(2)10(11(18)19)17-9-4-3-7(5-8(9)13)12(14,15)16/h3-6,10,17H,1-2H3,(H,18,19)/t10-/m0/s1

SMILES: CC(C)[C@@H](C(=O)O)Nc1ccc(cc1Cl)C(F)(F)F

2-{[2-chloro-4-(trifluoromethyl)phenyl]amino}-3-methylbutanoic acid

CAS: 76338-73-3

2-{[2-chloro-4-(trifluoromethyl)phenyl]amino}-3-methylbutanoic acid

Purity: 95%

Molecular weight: 295.69g/mol

Ref: 54-PC102099

2-{[2-chloro-4-(trifluoromethyl)phenyl]amino}-3-methylbutanoic acid

CAS: 76338-73-3

Purity: 95%

Molecular weight: 295.6900024

Ref: 10-F641291

2-{[2-Chloro-4-(trifluoromethyl)phenyl]amino}-3-methylbutanoic acid

CAS: 76338-73-3

Versatile small molecule scaffold

Formula: C₁₂H₁₃ClF₃NO₂

Purity: Min. 95%

Molecular weight: 295.68 g/mol

Ref: 3D-BDA33873