CAS 76338-90-4
:2-Amino-4-bromobutyric acid hydrobromide
Description:
2-Amino-4-bromobutyric acid hydrobromide is an organic compound characterized by its amino acid structure, featuring a bromine atom at the 4-position of the butyric acid backbone. It is a hydrobromide salt, indicating that it is typically encountered in its protonated form, which enhances its solubility in water. This compound is known for its potential applications in biochemical research, particularly in studies related to neurotransmitter systems, as it can act as a GABA (gamma-aminobutyric acid) analog. The presence of the amino group (-NH2) contributes to its basicity, while the carboxylic acid group (-COOH) provides acidic properties. The bromine substituent can influence the compound's reactivity and biological activity. As with many amino acids and their derivatives, it may exhibit chirality, leading to different optical isomers. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Amino-4-bromobutyric acid hydrobromide is a significant compound in the field of medicinal chemistry and pharmacology.
Formula:C4H8BrNO2·BrH
InChI:InChI=1S/C4H8BrNO2.BrH/c5-2-1-3(6)4(7)8;/h3H,1-2,6H2,(H,7,8);1H
InChI key:InChIKey=JDLMXICGDYZOJH-UHFFFAOYSA-N
SMILES:C(CCBr)(C(O)=O)N.Br
Synonyms:- 2-Amino-4-bromobutanoic acid hydrobromide
- 2-Amino-4-bromobutyric acid hydrobromide
- Butyric acid, 2-amino-4-bromo-, hydrobromide
- Butanoic acid, 2-amino-4-bromo-, hydrobromide
- Butanoic acid, 2-amino-4-bromo-, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
