CAS 7634-42-6

1,4-Dimercapto-2,3-butanediol

Description:

1,4-Dimercapto-2,3-butanediol, with the CAS number 7634-42-6, is an organosulfur compound characterized by the presence of two thiol (-SH) groups and two hydroxyl (-OH) groups in its molecular structure. This compound is typically a colorless to pale yellow liquid and is known for its strong odor associated with thiols. It exhibits high solubility in water due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The thiol groups contribute to its reactivity, making it a useful reducing agent and a potential ligand in coordination chemistry. Additionally, 1,4-Dimercapto-2,3-butanediol can participate in various chemical reactions, including oxidation and complexation with metals. Its properties make it of interest in fields such as biochemistry, materials science, and environmental chemistry, particularly in applications involving heavy metal chelation and as a stabilizing agent in certain formulations. However, safety precautions should be taken when handling this compound due to its potential toxicity and strong odor.

Formula: C₄H₁₀O₂S₂

InChI: InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2

InChI key: InChIKey=VHJLVAABSRFDPM-UHFFFAOYSA-N

SMILES: C(C(CS)O)(CS)O

Synonyms:

• 1,4-Disulfanylbutane-2,3-diol
• 1,4-Bis(sulfanyl)butane-2,3-diol
• 1,4-Dimercapto-2,3-butanediol
• 2,3-Butanediol, 1,4-dimercapto-