CAS 76343-98-1

[2-(1-methylpropyl)phenoxy]acetic acid

Description:

[2-(1-methylpropyl)phenoxy]acetic acid, with the CAS number 76343-98-1, is a chemical compound that belongs to the class of phenoxyacetic acids. It is characterized by the presence of a phenoxy group, which is a phenyl ring bonded to an ether oxygen, and an acetic acid moiety. This compound typically exhibits properties such as being a white to off-white solid or crystalline substance, with moderate solubility in organic solvents and limited solubility in water. Its structure suggests potential applications in agricultural chemistry, particularly as a herbicide or plant growth regulator, due to its ability to interact with plant hormone pathways. The compound may also exhibit biological activity, influencing various physiological processes in plants. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with exposure. Overall, [2-(1-methylpropyl)phenoxy]acetic acid is notable for its structural features and potential utility in agricultural applications.

Formula: C₁₂H₁₆O₃

InChI: InChI=1/C12H16O3/c1-3-9(2)10-6-4-5-7-11(10)15-8-12(13)14/h4-7,9H,3,8H2,1-2H3,(H,13,14)

SMILES: CCC(C)c1ccccc1OCC(=O)O

Synonyms:

• (2-sec-Butylphenoxy)acetic acid
• Acetic Acid, 2-[2-(1-Methylpropyl)Phenoxy]-

Acetic acid,2-[2-(1-methylpropyl)phenoxy]-

CAS: 76343-98-1

Formula: C₁₂H₁₆O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.2536

Ref: IN-DA00562X

2-(2-(sec-Butyl)phenoxy)acetic acid

CAS: 76343-98-1

2-(2-(sec-Butyl)phenoxy)acetic acid

Purity: 95%

Molecular weight: 208.26g/mol

Ref: 54-OR1052082

(2-sec-butylphenoxy)acetic acid

CAS: 76343-98-1

Formula: C₁₂H₁₆O₃

Purity: 95%

Molecular weight: 208.257

Ref: 10-F310099

2-[2-(sec-Butyl)phenoxy]acetic acid

CAS: 76343-98-1

Versatile small molecule scaffold

Formula: C₁₂H₁₆O₃

Purity: Min. 95%

Molecular weight: 208.26 g/mol

Ref: 3D-BDA34398