CAS 76344-88-2

ethyl 5-(4-fluorophenyl)isoxazole-4-carboxylate

Description:

Ethyl 5-(4-fluorophenyl)isoxazole-4-carboxylate is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a carboxylate functional group, which contributes to its reactivity and solubility properties. The presence of the 4-fluorophenyl substituent enhances its biological activity and can influence its pharmacological properties. Ethyl 5-(4-fluorophenyl)isoxazole-4-carboxylate is typically a white to off-white solid, and its molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. The compound may exhibit specific biological activities, potentially acting as an intermediate in the synthesis of pharmaceuticals or as a lead compound in drug discovery. Its CAS number, 76344-88-2, is a unique identifier that facilitates the search for information regarding its properties, safety data, and applications in scientific literature and databases.

Formula: C₁₂H₁₀FNO₃

InChI: InChI=1/C12H10FNO3/c1-2-16-12(15)10-7-14-17-11(10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3

SMILES: CCOC(=O)c1cnoc1c1ccc(cc1)F

Synonyms:

• Ethyl 5-(4-fluorophenyl)-1,2-oxazole-4-carboxylate