CAS 76344-95-1

5-phenyl-1,2-oxazole-4-carboxylic acid

Description:

5-Phenyl-1,2-oxazole-4-carboxylic acid is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a phenyl group attached to the oxazole ring, contributing to its aromatic properties and potential reactivity. The carboxylic acid functional group (-COOH) at the 4-position of the oxazole ring imparts acidic characteristics, allowing for proton donation in aqueous solutions. This compound is typically used in various chemical syntheses and may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it may participate in hydrogen bonding due to the presence of the carboxylic acid group. The molecular structure allows for potential interactions with biological targets, which can be explored in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.

Formula: C₁₀H₇NO₃

InChI: InChI=1/C10H7NO3/c12-10(13)8-6-11-14-9(8)7-4-2-1-3-5-7/h1-6H,(H,12,13)

SMILES: c1ccc(cc1)c1c(cno1)C(=O)O

5-Phenylisoxazole-4-carboxylic acid

CAS: 76344-95-1

Formula: C₁₀H₇NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 189.1675

Ref: IN-DA005DZ3

5-Phenyl-1,2-Oxazole-4-Carboxylic Acid

CAS: 76344-95-1

5-Phenyl-1,2-Oxazole-4-Carboxylic Acid

Purity: 98%

Molecular weight: 189.17g/mol

Ref: 54-OR1027763

5-phenyl-4-isoxazolecarboxylic acid

CAS: 76344-95-1

Formula: C₁₀H₇NO₃

Purity: 98%(LC-MS);RG

Molecular weight: 189.17

Ref: 10-F312985