CAS 76347-13-2
:4,4,5,5-tetramethyl-2-(propan-2-yl)-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-(propan-2-yl)-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane ring structure, which contains boron and oxygen atoms. This compound features a boron atom bonded to two oxygen atoms in a cyclic arrangement, contributing to its stability and reactivity. The presence of four methyl groups and an isopropyl group enhances its steric bulk, influencing its chemical behavior and solubility in organic solvents. Typically, compounds like this are utilized in organic synthesis, particularly in the formation of carbon-boron bonds, which are valuable in various chemical transformations, including cross-coupling reactions. The dioxaborolane structure also allows for potential applications in materials science and medicinal chemistry, where boron-containing compounds are of interest for their unique properties. Additionally, the compound's stability under ambient conditions makes it suitable for various laboratory applications. However, specific handling and storage conditions should be observed due to the potential reactivity of organoboron compounds.
Formula:C9H19BO2
InChI:InChI=1/C9H19BO2/c1-7(2)10-11-8(3,4)9(5,6)12-10/h7H,1-6H3
SMILES:CC(C)B1OC(C)(C)C(C)(C)O1
Synonyms:- 2-isoPropylboronic acid pinacol ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Isopropylboronic acid pinacol ester, 97%
CAS:Isopropylboronic acid pinacol ester is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or S
Formula:C9H19BO2Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:170.062-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C9H19BO2Purity:97%Color and Shape:LiquidMolecular weight:170.05702-Isopropylboronic acid pinacol ester
CAS:2-Isopropylboronic acid pinacol esterPurity:98%Molecular weight:170.06g/mol2-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C9H19BO2Purity:>95.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:170.062-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C9H19BO2Purity:97%Color and Shape:LiquidMolecular weight:170.06




